About barium(2+);carbonate;chloride
barium(2+);carbonate;chloride (PubChem CID 21197201) has the molecular formula CBaClO3-
and a molecular weight of 232.79 g/mol. Its IUPAC name is barium(2+);carbonate;chloride.
Molecular Properties
| Compound Name | barium(2+);carbonate;chloride |
| PubChem CID | 21197201 |
| Molecular Formula | CBaClO3- |
| Molecular Weight | 232.79 g/mol |
| Exact Mass | 232.86 |
| IUPAC Name | barium(2+);carbonate;chloride |
| SMILES | O=C([O-])[O-].[Ba+2].[Cl-] |
| InChI | InChI=1S/CH2O3.Ba.ClH/c2-1(3)4;;/h(H2,2,3,4);;1H/q;+2;/p-3 |
| InChIKey | LKOGCJXBXLUJIB-UHFFFAOYSA-K |
| XLogP | -5.82 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.79 |
| LogP ≤ 5 | -5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze barium(2+);carbonate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);carbonate;chloride?
The IUPAC name of barium(2+);carbonate;chloride (CID 21197201) is barium(2+);carbonate;chloride.
What is the SMILES notation for barium(2+);carbonate;chloride?
The canonical SMILES for barium(2+);carbonate;chloride is O=C([O-])[O-].[Ba+2].[Cl-].
What is the InChIKey of barium(2+);carbonate;chloride?
The InChIKey is LKOGCJXBXLUJIB-UHFFFAOYSA-K. The full InChI is InChI=1S/CH2O3.Ba.ClH/c2-1(3)4;;/h(H2,2,3,4);;1H/q;+2;/p-3.
What are the key properties of barium(2+);carbonate;chloride?
barium(2+);carbonate;chloride has a molecular weight of 232.79 g/mol, XLogP of -5.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);carbonate;chloride is sourced from PubChem (CID 21197201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).