About barium(2+);boric acid;carbonate
barium(2+);boric acid;carbonate (PubChem CID 175313768) has the molecular formula CH3BBaO6
and a molecular weight of 259.17 g/mol. Its IUPAC name is barium(2+);boric acid;carbonate.
Molecular Properties
| Compound Name | barium(2+);boric acid;carbonate |
| PubChem CID | 175313768 |
| Molecular Formula | CH3BBaO6 |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.91 |
| IUPAC Name | barium(2+);boric acid;carbonate |
| SMILES | O=C([O-])[O-].OB(O)O.[Ba+2] |
| InChI | InChI=1S/CH2O3.BH3O3.Ba/c2*2-1(3)4;/h(H2,2,3,4);2-4H;/q;;+2/p-2 |
| InChIKey | KOEVBSWRLRUHAN-UHFFFAOYSA-L |
| XLogP | -4.88 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);boric acid;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);boric acid;carbonate?
The IUPAC name of barium(2+);boric acid;carbonate (CID 175313768) is barium(2+);boric acid;carbonate.
What is the SMILES notation for barium(2+);boric acid;carbonate?
The canonical SMILES for barium(2+);boric acid;carbonate is O=C([O-])[O-].OB(O)O.[Ba+2].
What is the InChIKey of barium(2+);boric acid;carbonate?
The InChIKey is KOEVBSWRLRUHAN-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.BH3O3.Ba/c2*2-1(3)4;/h(H2,2,3,4);2-4H;/q;;+2/p-2.
What are the key properties of barium(2+);boric acid;carbonate?
barium(2+);boric acid;carbonate has a molecular weight of 259.17 g/mol, XLogP of -4.88, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);boric acid;carbonate is sourced from PubChem (CID 175313768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).