About barium(2+);hydrogen carbonate;chloride
barium(2+);hydrogen carbonate;chloride (PubChem CID 88771377) has the molecular formula CHBaClO3
and a molecular weight of 233.80 g/mol. Its IUPAC name is barium(2+);hydrogen carbonate;chloride.
Molecular Properties
| Compound Name | barium(2+);hydrogen carbonate;chloride |
| PubChem CID | 88771377 |
| Molecular Formula | CHBaClO3 |
| Molecular Weight | 233.80 g/mol |
| Exact Mass | 233.87 |
| IUPAC Name | barium(2+);hydrogen carbonate;chloride |
| SMILES | O=C([O-])O.[Ba+2].[Cl-] |
| InChI | InChI=1S/CH2O3.Ba.ClH/c2-1(3)4;;/h(H2,2,3,4);;1H/q;+2;/p-2 |
| InChIKey | LKOGCJXBXLUJIB-UHFFFAOYSA-L |
| XLogP | -4.49 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.80 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze barium(2+);hydrogen carbonate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);hydrogen carbonate;chloride?
The IUPAC name of barium(2+);hydrogen carbonate;chloride (CID 88771377) is barium(2+);hydrogen carbonate;chloride.
What is the SMILES notation for barium(2+);hydrogen carbonate;chloride?
The canonical SMILES for barium(2+);hydrogen carbonate;chloride is O=C([O-])O.[Ba+2].[Cl-].
What is the InChIKey of barium(2+);hydrogen carbonate;chloride?
The InChIKey is LKOGCJXBXLUJIB-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Ba.ClH/c2-1(3)4;;/h(H2,2,3,4);;1H/q;+2;/p-2.
What are the key properties of barium(2+);hydrogen carbonate;chloride?
barium(2+);hydrogen carbonate;chloride has a molecular weight of 233.80 g/mol, XLogP of -4.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);hydrogen carbonate;chloride is sourced from PubChem (CID 88771377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).