About zinc;hydrogen carbonate;chloride
zinc;hydrogen carbonate;chloride (PubChem CID 146216563) has the molecular formula CHClO3Zn
and a molecular weight of 161.86 g/mol. Its IUPAC name is zinc;hydrogen carbonate;chloride.
Molecular Properties
| Compound Name | zinc;hydrogen carbonate;chloride |
| PubChem CID | 146216563 |
| Molecular Formula | CHClO3Zn |
| Molecular Weight | 161.86 g/mol |
| Exact Mass | 159.89 |
| IUPAC Name | zinc;hydrogen carbonate;chloride |
| SMILES | O=C([O-])O.[Cl-].[Zn+2] |
| InChI | InChI=1S/CH2O3.ClH.Zn/c2-1(3)4;;/h(H2,2,3,4);1H;/q;;+2/p-2 |
| InChIKey | BPSZCTCPJAIAHL-UHFFFAOYSA-L |
| XLogP | -4.11 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.86 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;hydrogen carbonate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;hydrogen carbonate;chloride?
The IUPAC name of zinc;hydrogen carbonate;chloride (CID 146216563) is zinc;hydrogen carbonate;chloride.
What is the SMILES notation for zinc;hydrogen carbonate;chloride?
The canonical SMILES for zinc;hydrogen carbonate;chloride is O=C([O-])O.[Cl-].[Zn+2].
What is the InChIKey of zinc;hydrogen carbonate;chloride?
The InChIKey is BPSZCTCPJAIAHL-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.ClH.Zn/c2-1(3)4;;/h(H2,2,3,4);1H;/q;;+2/p-2.
What are the key properties of zinc;hydrogen carbonate;chloride?
zinc;hydrogen carbonate;chloride has a molecular weight of 161.86 g/mol, XLogP of -4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;hydrogen carbonate;chloride is sourced from PubChem (CID 146216563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).