About cadmium(2+);hydrogen carbonate;chloride
cadmium(2+);hydrogen carbonate;chloride (PubChem CID 158411506) has the molecular formula CHCdClO3
and a molecular weight of 208.88 g/mol. Its IUPAC name is cadmium(2+);hydrogen carbonate;chloride.
Molecular Properties
| Compound Name | cadmium(2+);hydrogen carbonate;chloride |
| PubChem CID | 158411506 |
| Molecular Formula | CHCdClO3 |
| Molecular Weight | 208.88 g/mol |
| Exact Mass | 209.86 |
| IUPAC Name | cadmium(2+);hydrogen carbonate;chloride |
| SMILES | O=C([O-])O.[Cd+2].[Cl-] |
| InChI | InChI=1S/CH2O3.Cd.ClH/c2-1(3)4;;/h(H2,2,3,4);;1H/q;+2;/p-2 |
| InChIKey | GZJHUVANCZBMMS-UHFFFAOYSA-L |
| XLogP | -4.11 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.88 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cadmium(2+);hydrogen carbonate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);hydrogen carbonate;chloride?
The IUPAC name of cadmium(2+);hydrogen carbonate;chloride (CID 158411506) is cadmium(2+);hydrogen carbonate;chloride.
What is the SMILES notation for cadmium(2+);hydrogen carbonate;chloride?
The canonical SMILES for cadmium(2+);hydrogen carbonate;chloride is O=C([O-])O.[Cd+2].[Cl-].
What is the InChIKey of cadmium(2+);hydrogen carbonate;chloride?
The InChIKey is GZJHUVANCZBMMS-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Cd.ClH/c2-1(3)4;;/h(H2,2,3,4);;1H/q;+2;/p-2.
What are the key properties of cadmium(2+);hydrogen carbonate;chloride?
cadmium(2+);hydrogen carbonate;chloride has a molecular weight of 208.88 g/mol, XLogP of -4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);hydrogen carbonate;chloride is sourced from PubChem (CID 158411506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).