About cadmium(2+);hydrogen carbonate
cadmium(2+);hydrogen carbonate (PubChem CID 14094645) has the molecular formula C2H2CdO6
and a molecular weight of 234.44 g/mol. Its IUPAC name is cadmium(2+);hydrogen carbonate.
Molecular Properties
| Compound Name | cadmium(2+);hydrogen carbonate |
| PubChem CID | 14094645 |
| Molecular Formula | C2H2CdO6 |
| Molecular Weight | 234.44 g/mol |
| Exact Mass | 235.89 |
| IUPAC Name | cadmium(2+);hydrogen carbonate |
| SMILES | O=C([O-])O.O=C([O-])O.[Cd+2] |
| InChI | InChI=1S/2CH2O3.Cd/c2*2-1(3)4;/h2*(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | ODYFKJUYWXSYJA-UHFFFAOYSA-L |
| XLogP | -2.23 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.44 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cadmium(2+);hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);hydrogen carbonate?
The IUPAC name of cadmium(2+);hydrogen carbonate (CID 14094645) is cadmium(2+);hydrogen carbonate.
What is the SMILES notation for cadmium(2+);hydrogen carbonate?
The canonical SMILES for cadmium(2+);hydrogen carbonate is O=C([O-])O.O=C([O-])O.[Cd+2].
What is the InChIKey of cadmium(2+);hydrogen carbonate?
The InChIKey is ODYFKJUYWXSYJA-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH2O3.Cd/c2*2-1(3)4;/h2*(H2,2,3,4);/q;;+2/p-2.
What are the key properties of cadmium(2+);hydrogen carbonate?
cadmium(2+);hydrogen carbonate has a molecular weight of 234.44 g/mol, XLogP of -2.23, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);hydrogen carbonate is sourced from PubChem (CID 14094645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).