About hydrogen carbonate;mercury(2+)
hydrogen carbonate;mercury(2+) (PubChem CID 23147660) has the molecular formula C2H2HgO6
and a molecular weight of 322.62 g/mol. Its IUPAC name is hydrogen carbonate;mercury(2+).
Molecular Properties
| Compound Name | hydrogen carbonate;mercury(2+) |
| PubChem CID | 23147660 |
| Molecular Formula | C2H2HgO6 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | hydrogen carbonate;mercury(2+) |
| SMILES | O=C([O-])O.O=C([O-])O.[Hg+2] |
| InChI | InChI=1S/2CH2O3.Hg/c2*2-1(3)4;/h2*(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | BWVVRJMFHRBUFM-UHFFFAOYSA-L |
| XLogP | -2.23 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydrogen carbonate;mercury(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen carbonate;mercury(2+)?
The IUPAC name of hydrogen carbonate;mercury(2+) (CID 23147660) is hydrogen carbonate;mercury(2+).
What is the SMILES notation for hydrogen carbonate;mercury(2+)?
The canonical SMILES for hydrogen carbonate;mercury(2+) is O=C([O-])O.O=C([O-])O.[Hg+2].
What is the InChIKey of hydrogen carbonate;mercury(2+)?
The InChIKey is BWVVRJMFHRBUFM-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH2O3.Hg/c2*2-1(3)4;/h2*(H2,2,3,4);/q;;+2/p-2.
What are the key properties of hydrogen carbonate;mercury(2+)?
hydrogen carbonate;mercury(2+) has a molecular weight of 322.62 g/mol, XLogP of -2.23, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen carbonate;mercury(2+) is sourced from PubChem (CID 23147660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).