About aluminum;hydrogen carbonate;oxygen(2-)
aluminum;hydrogen carbonate;oxygen(2-) (PubChem CID 90004700) has the molecular formula CHAlO4
and a molecular weight of 104.00 g/mol. Its IUPAC name is aluminum;hydrogen carbonate;oxygen(2-).
Molecular Properties
| Compound Name | aluminum;hydrogen carbonate;oxygen(2-) |
| PubChem CID | 90004700 |
| Molecular Formula | CHAlO4 |
| Molecular Weight | 104.00 g/mol |
| Exact Mass | 103.97 |
| IUPAC Name | aluminum;hydrogen carbonate;oxygen(2-) |
| SMILES | O=C([O-])O.[Al+3].[O-2] |
| InChI | InChI=1S/CH2O3.Al.O/c2-1(3)4;;/h(H2,2,3,4);;/q;+3;-2/p-1 |
| InChIKey | UHHZBTHFJAJICO-UHFFFAOYSA-M |
| XLogP | -1.61 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.00 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze aluminum;hydrogen carbonate;oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;hydrogen carbonate;oxygen(2-)?
The IUPAC name of aluminum;hydrogen carbonate;oxygen(2-) (CID 90004700) is aluminum;hydrogen carbonate;oxygen(2-).
What is the SMILES notation for aluminum;hydrogen carbonate;oxygen(2-)?
The canonical SMILES for aluminum;hydrogen carbonate;oxygen(2-) is O=C([O-])O.[Al+3].[O-2].
What is the InChIKey of aluminum;hydrogen carbonate;oxygen(2-)?
The InChIKey is UHHZBTHFJAJICO-UHFFFAOYSA-M. The full InChI is InChI=1S/CH2O3.Al.O/c2-1(3)4;;/h(H2,2,3,4);;/q;+3;-2/p-1.
What are the key properties of aluminum;hydrogen carbonate;oxygen(2-)?
aluminum;hydrogen carbonate;oxygen(2-) has a molecular weight of 104.00 g/mol, XLogP of -1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;hydrogen carbonate;oxygen(2-) is sourced from PubChem (CID 90004700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).