About azane;platinum(2+);carbonate
azane;platinum(2+);carbonate (PubChem CID 22123677) has the molecular formula CH12N4O3Pt
and a molecular weight of 323.21 g/mol. Its IUPAC name is azane;platinum(2+);carbonate.
Molecular Properties
| Compound Name | azane;platinum(2+);carbonate |
| PubChem CID | 22123677 |
| Molecular Formula | CH12N4O3Pt |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | azane;platinum(2+);carbonate |
| SMILES | N.N.N.N.O=C([O-])[O-].[Pt+2] |
| InChI | InChI=1S/CH2O3.4H3N.Pt/c2-1(3)4;;;;;/h(H2,2,3,4);4*1H3;/q;;;;;+2/p-2 |
| InChIKey | NPEIEWFLIOFVPB-UHFFFAOYSA-L |
| XLogP | -1.80 |
| TPSA | 203.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze azane;platinum(2+);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;platinum(2+);carbonate?
The IUPAC name of azane;platinum(2+);carbonate (CID 22123677) is azane;platinum(2+);carbonate.
What is the SMILES notation for azane;platinum(2+);carbonate?
The canonical SMILES for azane;platinum(2+);carbonate is N.N.N.N.O=C([O-])[O-].[Pt+2].
What is the InChIKey of azane;platinum(2+);carbonate?
The InChIKey is NPEIEWFLIOFVPB-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.4H3N.Pt/c2-1(3)4;;;;;/h(H2,2,3,4);4*1H3;/q;;;;;+2/p-2.
What are the key properties of azane;platinum(2+);carbonate?
azane;platinum(2+);carbonate has a molecular weight of 323.21 g/mol, XLogP of -1.80, 0 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;platinum(2+);carbonate is sourced from PubChem (CID 22123677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).