About zinc;azane;carbonate
zinc;azane;carbonate (PubChem CID 14029939) has the molecular formula CH3NO3Zn
and a molecular weight of 142.43 g/mol. Its IUPAC name is zinc;azane;carbonate.
Molecular Properties
| Compound Name | zinc;azane;carbonate |
| PubChem CID | 14029939 |
| Molecular Formula | CH3NO3Zn |
| Molecular Weight | 142.43 g/mol |
| Exact Mass | 140.94 |
| IUPAC Name | zinc;azane;carbonate |
| SMILES | N.O=C([O-])[O-].[Zn+2] |
| InChI | InChI=1S/CH2O3.H3N.Zn/c2-1(3)4;;/h(H2,2,3,4);1H3;/q;;+2/p-2 |
| InChIKey | CUHLTWOGTOCQBK-UHFFFAOYSA-L |
| XLogP | -2.29 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.43 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;azane;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;azane;carbonate?
The IUPAC name of zinc;azane;carbonate (CID 14029939) is zinc;azane;carbonate.
What is the SMILES notation for zinc;azane;carbonate?
The canonical SMILES for zinc;azane;carbonate is N.O=C([O-])[O-].[Zn+2].
What is the InChIKey of zinc;azane;carbonate?
The InChIKey is CUHLTWOGTOCQBK-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.H3N.Zn/c2-1(3)4;;/h(H2,2,3,4);1H3;/q;;+2/p-2.
What are the key properties of zinc;azane;carbonate?
zinc;azane;carbonate has a molecular weight of 142.43 g/mol, XLogP of -2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;azane;carbonate is sourced from PubChem (CID 14029939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).