About zinc;zinc;carbonate;dihydrate
zinc;zinc;carbonate;dihydrate (PubChem CID 11310663) has the molecular formula CH4O5Zn2
and a molecular weight of 226.82 g/mol. Its IUPAC name is zinc;zinc;carbonate;dihydrate.
Molecular Properties
| Compound Name | zinc;zinc;carbonate;dihydrate |
| PubChem CID | 11310663 |
| Molecular Formula | CH4O5Zn2 |
| Molecular Weight | 226.82 g/mol |
| Exact Mass | 223.86 |
| IUPAC Name | zinc;zinc;carbonate;dihydrate |
| SMILES | O.O.O=C([O-])[O-].[Zn+2].[Zn] |
| InChI | InChI=1S/CH2O3.2H2O.2Zn/c2-1(3)4;;;;/h(H2,2,3,4);2*1H2;;/q;;;;+2/p-2 |
| InChIKey | PUAZZSVJUBELPQ-UHFFFAOYSA-L |
| XLogP | -4.10 |
| TPSA | 126.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.82 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;zinc;carbonate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;zinc;carbonate;dihydrate?
The IUPAC name of zinc;zinc;carbonate;dihydrate (CID 11310663) is zinc;zinc;carbonate;dihydrate.
What is the SMILES notation for zinc;zinc;carbonate;dihydrate?
The canonical SMILES for zinc;zinc;carbonate;dihydrate is O.O.O=C([O-])[O-].[Zn+2].[Zn].
What is the InChIKey of zinc;zinc;carbonate;dihydrate?
The InChIKey is PUAZZSVJUBELPQ-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.2H2O.2Zn/c2-1(3)4;;;;/h(H2,2,3,4);2*1H2;;/q;;;;+2/p-2.
What are the key properties of zinc;zinc;carbonate;dihydrate?
zinc;zinc;carbonate;dihydrate has a molecular weight of 226.82 g/mol, XLogP of -4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;zinc;carbonate;dihydrate is sourced from PubChem (CID 11310663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).