About zinc;oxalate;dihydrate
zinc;oxalate;dihydrate (PubChem CID 516787) has the molecular formula C2H4O6Zn
and a molecular weight of 189.44 g/mol. Its IUPAC name is zinc;oxalate;dihydrate.
Molecular Properties
| Compound Name | zinc;oxalate;dihydrate |
| PubChem CID | 516787 |
| Molecular Formula | C2H4O6Zn |
| Molecular Weight | 189.44 g/mol |
| Exact Mass | 187.93 |
| IUPAC Name | zinc;oxalate;dihydrate |
| SMILES | O.O.O=C([O-])C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C2H2O4.2H2O.Zn/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);2*1H2;/q;;;+2/p-2 |
| InChIKey | WCKIDCVWRJUPFY-UHFFFAOYSA-L |
| XLogP | -5.17 |
| TPSA | 143.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.44 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;oxalate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;oxalate;dihydrate?
The IUPAC name of zinc;oxalate;dihydrate (CID 516787) is zinc;oxalate;dihydrate.
What is the SMILES notation for zinc;oxalate;dihydrate?
The canonical SMILES for zinc;oxalate;dihydrate is O.O.O=C([O-])C(=O)[O-].[Zn+2].
What is the InChIKey of zinc;oxalate;dihydrate?
The InChIKey is WCKIDCVWRJUPFY-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.2H2O.Zn/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);2*1H2;/q;;;+2/p-2.
What are the key properties of zinc;oxalate;dihydrate?
zinc;oxalate;dihydrate has a molecular weight of 189.44 g/mol, XLogP of -5.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;oxalate;dihydrate is sourced from PubChem (CID 516787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).