About lanthanum(3+);carbonate;hydroxide;hydrate
lanthanum(3+);carbonate;hydroxide;hydrate (PubChem CID 173093313) has the molecular formula CH3LaO5
and a molecular weight of 233.94 g/mol. Its IUPAC name is lanthanum(3+);carbonate;hydroxide;hydrate.
Molecular Properties
| Compound Name | lanthanum(3+);carbonate;hydroxide;hydrate |
| PubChem CID | 173093313 |
| Molecular Formula | CH3LaO5 |
| Molecular Weight | 233.94 g/mol |
| Exact Mass | 233.90 |
| IUPAC Name | lanthanum(3+);carbonate;hydroxide;hydrate |
| SMILES | O.O=C([O-])[O-].[La+3].[OH-] |
| InChI | InChI=1S/CH2O3.La.2H2O/c2-1(3)4;;;/h(H2,2,3,4);;2*1H2/q;+3;;/p-3 |
| InChIKey | ORHQXOJKIXYRMA-UHFFFAOYSA-K |
| XLogP | -3.45 |
| TPSA | 124.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.94 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lanthanum(3+);carbonate;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum(3+);carbonate;hydroxide;hydrate?
The IUPAC name of lanthanum(3+);carbonate;hydroxide;hydrate (CID 173093313) is lanthanum(3+);carbonate;hydroxide;hydrate.
What is the SMILES notation for lanthanum(3+);carbonate;hydroxide;hydrate?
The canonical SMILES for lanthanum(3+);carbonate;hydroxide;hydrate is O.O=C([O-])[O-].[La+3].[OH-].
What is the InChIKey of lanthanum(3+);carbonate;hydroxide;hydrate?
The InChIKey is ORHQXOJKIXYRMA-UHFFFAOYSA-K. The full InChI is InChI=1S/CH2O3.La.2H2O/c2-1(3)4;;;/h(H2,2,3,4);;2*1H2/q;+3;;/p-3.
What are the key properties of lanthanum(3+);carbonate;hydroxide;hydrate?
lanthanum(3+);carbonate;hydroxide;hydrate has a molecular weight of 233.94 g/mol, XLogP of -3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum(3+);carbonate;hydroxide;hydrate is sourced from PubChem (CID 173093313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).