About CID 170839506
CID 170839506 (PubChem CID 170839506) has the molecular formula CHMgO4-3
and a molecular weight of 101.32 g/mol.
Molecular Properties
| Compound Name | CID 170839506 |
| PubChem CID | 170839506 |
| Molecular Formula | CHMgO4-3 |
| Molecular Weight | 101.32 g/mol |
| Exact Mass | 100.97 |
| IUPAC Name | — |
| SMILES | O=C([O-])[O-].[Mg].[OH-] |
| InChI | InChI=1S/CH2O3.Mg.H2O/c2-1(3)4;;/h(H2,2,3,4);;1H2/p-3 |
| InChIKey | RERJDXWWVICIRN-UHFFFAOYSA-K |
| XLogP | -3.00 |
| TPSA | 93.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.32 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 170839506 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170839506?
The IUPAC name of CID 170839506 (CID 170839506) is not available.
What is the SMILES notation for CID 170839506?
The canonical SMILES for CID 170839506 is O=C([O-])[O-].[Mg].[OH-].
What is the InChIKey of CID 170839506?
The InChIKey is RERJDXWWVICIRN-UHFFFAOYSA-K. The full InChI is InChI=1S/CH2O3.Mg.H2O/c2-1(3)4;;/h(H2,2,3,4);;1H2/p-3.
What are the key properties of CID 170839506?
CID 170839506 has a molecular weight of 101.32 g/mol, XLogP of -3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170839506 is sourced from PubChem (CID 170839506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).