About cobalt;carbonate;hydroxide
cobalt;carbonate;hydroxide (PubChem CID 5362494) has the molecular formula CHCoO4-3
and a molecular weight of 135.95 g/mol. Its IUPAC name is cobalt;carbonate;hydroxide.
Molecular Properties
| Compound Name | cobalt;carbonate;hydroxide |
| PubChem CID | 5362494 |
| Molecular Formula | CHCoO4-3 |
| Molecular Weight | 135.95 g/mol |
| Exact Mass | 135.92 |
| IUPAC Name | cobalt;carbonate;hydroxide |
| SMILES | O=C([O-])[O-].[Co].[OH-] |
| InChI | InChI=1S/CH2O3.Co.H2O/c2-1(3)4;;/h(H2,2,3,4);;1H2/p-3 |
| InChIKey | AMBICLBCMQSUDI-UHFFFAOYSA-K |
| XLogP | -2.63 |
| TPSA | 93.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.95 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cobalt;carbonate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;carbonate;hydroxide?
The IUPAC name of cobalt;carbonate;hydroxide (CID 5362494) is cobalt;carbonate;hydroxide.
What is the SMILES notation for cobalt;carbonate;hydroxide?
The canonical SMILES for cobalt;carbonate;hydroxide is O=C([O-])[O-].[Co].[OH-].
What is the InChIKey of cobalt;carbonate;hydroxide?
The InChIKey is AMBICLBCMQSUDI-UHFFFAOYSA-K. The full InChI is InChI=1S/CH2O3.Co.H2O/c2-1(3)4;;/h(H2,2,3,4);;1H2/p-3.
What are the key properties of cobalt;carbonate;hydroxide?
cobalt;carbonate;hydroxide has a molecular weight of 135.95 g/mol, XLogP of -2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;carbonate;hydroxide is sourced from PubChem (CID 5362494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).