About bis(zirconium(2+));carbonate;dihydroxide;dihydrate
bis(zirconium(2+));carbonate;dihydroxide;dihydrate (PubChem CID 131675351) has the molecular formula CH6O7Zr2
and a molecular weight of 312.50 g/mol. Its IUPAC name is bis(zirconium(2+));carbonate;dihydroxide;dihydrate.
Molecular Properties
| Compound Name | bis(zirconium(2+));carbonate;dihydroxide;dihydrate |
| PubChem CID | 131675351 |
| Molecular Formula | CH6O7Zr2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 309.82 |
| IUPAC Name | bis(zirconium(2+));carbonate;dihydroxide;dihydrate |
| SMILES | O.O.O=C([O-])[O-].[OH-].[OH-].[Zr+2].[Zr+2] |
| InChI | InChI=1S/CH2O3.4H2O.2Zr/c2-1(3)4;;;;;;/h(H2,2,3,4);4*1H2;;/q;;;;;2*+2/p-4 |
| InChIKey | JOADZWACLWUMON-UHFFFAOYSA-J |
| XLogP | -4.45 |
| TPSA | 186.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(zirconium(2+));carbonate;dihydroxide;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(zirconium(2+));carbonate;dihydroxide;dihydrate?
The IUPAC name of bis(zirconium(2+));carbonate;dihydroxide;dihydrate (CID 131675351) is bis(zirconium(2+));carbonate;dihydroxide;dihydrate.
What is the SMILES notation for bis(zirconium(2+));carbonate;dihydroxide;dihydrate?
The canonical SMILES for bis(zirconium(2+));carbonate;dihydroxide;dihydrate is O.O.O=C([O-])[O-].[OH-].[OH-].[Zr+2].[Zr+2].
What is the InChIKey of bis(zirconium(2+));carbonate;dihydroxide;dihydrate?
The InChIKey is JOADZWACLWUMON-UHFFFAOYSA-J. The full InChI is InChI=1S/CH2O3.4H2O.2Zr/c2-1(3)4;;;;;;/h(H2,2,3,4);4*1H2;;/q;;;;;2*+2/p-4.
What are the key properties of bis(zirconium(2+));carbonate;dihydroxide;dihydrate?
bis(zirconium(2+));carbonate;dihydroxide;dihydrate has a molecular weight of 312.50 g/mol, XLogP of -4.45, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(zirconium(2+));carbonate;dihydroxide;dihydrate is sourced from PubChem (CID 131675351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).