About disodium;carbonate;hydrate
disodium;carbonate;hydrate (PubChem CID 2735133) has the molecular formula CH2Na2O4
and a molecular weight of 124.00 g/mol. Its IUPAC name is disodium;carbonate;hydrate.
Molecular Properties
| Compound Name | disodium;carbonate;hydrate |
| PubChem CID | 2735133 |
| Molecular Formula | CH2Na2O4 |
| Molecular Weight | 124.00 g/mol |
| Exact Mass | 123.97 |
| IUPAC Name | disodium;carbonate;hydrate |
| SMILES | O.O=C([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/CH2O3.2Na.H2O/c2-1(3)4;;;/h(H2,2,3,4);;;1H2/q;2*+1;/p-2 |
| InChIKey | MQRJBSHKWOFOGF-UHFFFAOYSA-L |
| XLogP | -9.26 |
| TPSA | 94.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.00 |
| LogP ≤ 5 | -9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze disodium;carbonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;carbonate;hydrate?
The IUPAC name of disodium;carbonate;hydrate (CID 2735133) is disodium;carbonate;hydrate.
What is the SMILES notation for disodium;carbonate;hydrate?
The canonical SMILES for disodium;carbonate;hydrate is O.O=C([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;carbonate;hydrate?
The InChIKey is MQRJBSHKWOFOGF-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.2Na.H2O/c2-1(3)4;;;/h(H2,2,3,4);;;1H2/q;2*+1;/p-2.
What are the key properties of disodium;carbonate;hydrate?
disodium;carbonate;hydrate has a molecular weight of 124.00 g/mol, XLogP of -9.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;carbonate;hydrate is sourced from PubChem (CID 2735133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).