About sodium;silicon(4+);carbonate
sodium;silicon(4+);carbonate (PubChem CID 158531104) has the molecular formula CH8NaO3Si+3
and a molecular weight of 119.15 g/mol. Its IUPAC name is sodium;silicon(4+);carbonate.
Molecular Properties
| Compound Name | sodium;silicon(4+);carbonate |
| PubChem CID | 158531104 |
| Molecular Formula | CH8NaO3Si+3 |
| Molecular Weight | 119.15 g/mol |
| Exact Mass | 119.01 |
| IUPAC Name | sodium;silicon(4+);carbonate |
| SMILES | O=C([O-])[O-].[Na+].[SiH8+4] |
| InChI | InChI=1S/CH2O3.Na.H8Si/c2-1(3)4;;/h(H2,2,3,4);;1H8/q;+1;+4/p-2 |
| InChIKey | RIKREVDJGOXWBE-UHFFFAOYSA-L |
| XLogP | -7.97 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.15 |
| LogP ≤ 5 | -7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;silicon(4+);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;silicon(4+);carbonate?
The IUPAC name of sodium;silicon(4+);carbonate (CID 158531104) is sodium;silicon(4+);carbonate.
What is the SMILES notation for sodium;silicon(4+);carbonate?
The canonical SMILES for sodium;silicon(4+);carbonate is O=C([O-])[O-].[Na+].[SiH8+4].
What is the InChIKey of sodium;silicon(4+);carbonate?
The InChIKey is RIKREVDJGOXWBE-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Na.H8Si/c2-1(3)4;;/h(H2,2,3,4);;1H8/q;+1;+4/p-2.
What are the key properties of sodium;silicon(4+);carbonate?
sodium;silicon(4+);carbonate has a molecular weight of 119.15 g/mol, XLogP of -7.97, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;silicon(4+);carbonate is sourced from PubChem (CID 158531104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).