About disodium;titanium;carbonate
disodium;titanium;carbonate (PubChem CID 174855593) has the molecular formula CNa2O3Ti
and a molecular weight of 153.85 g/mol. Its IUPAC name is disodium;titanium;carbonate.
Molecular Properties
| Compound Name | disodium;titanium;carbonate |
| PubChem CID | 174855593 |
| Molecular Formula | CNa2O3Ti |
| Molecular Weight | 153.85 g/mol |
| Exact Mass | 153.91 |
| IUPAC Name | disodium;titanium;carbonate |
| SMILES | O=C([O-])[O-].[Na+].[Na+].[Ti] |
| InChI | InChI=1S/CH2O3.2Na.Ti/c2-1(3)4;;;/h(H2,2,3,4);;;/q;2*+1;/p-2 |
| InChIKey | XDMHGCLSSVSAME-UHFFFAOYSA-L |
| XLogP | -8.44 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.85 |
| LogP ≤ 5 | -8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze disodium;titanium;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;titanium;carbonate?
The IUPAC name of disodium;titanium;carbonate (CID 174855593) is disodium;titanium;carbonate.
What is the SMILES notation for disodium;titanium;carbonate?
The canonical SMILES for disodium;titanium;carbonate is O=C([O-])[O-].[Na+].[Na+].[Ti].
What is the InChIKey of disodium;titanium;carbonate?
The InChIKey is XDMHGCLSSVSAME-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.2Na.Ti/c2-1(3)4;;;/h(H2,2,3,4);;;/q;2*+1;/p-2.
What are the key properties of disodium;titanium;carbonate?
disodium;titanium;carbonate has a molecular weight of 153.85 g/mol, XLogP of -8.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;titanium;carbonate is sourced from PubChem (CID 174855593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).