About trisodium;zirconium(4+);carbonate
trisodium;zirconium(4+);carbonate (PubChem CID 160948124) has the molecular formula CNa3O3Zr+5
and a molecular weight of 220.20 g/mol. Its IUPAC name is trisodium;zirconium(4+);carbonate.
Molecular Properties
| Compound Name | trisodium;zirconium(4+);carbonate |
| PubChem CID | 160948124 |
| Molecular Formula | CNa3O3Zr+5 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 218.86 |
| IUPAC Name | trisodium;zirconium(4+);carbonate |
| SMILES | O=C([O-])[O-].[Na+].[Na+].[Na+].[Zr+4] |
| InChI | InChI=1S/CH2O3.3Na.Zr/c2-1(3)4;;;;/h(H2,2,3,4);;;;/q;3*+1;+4/p-2 |
| InChIKey | SVJUNNKTILBNBJ-UHFFFAOYSA-L |
| XLogP | -11.44 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | -11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trisodium;zirconium(4+);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;zirconium(4+);carbonate?
The IUPAC name of trisodium;zirconium(4+);carbonate (CID 160948124) is trisodium;zirconium(4+);carbonate.
What is the SMILES notation for trisodium;zirconium(4+);carbonate?
The canonical SMILES for trisodium;zirconium(4+);carbonate is O=C([O-])[O-].[Na+].[Na+].[Na+].[Zr+4].
What is the InChIKey of trisodium;zirconium(4+);carbonate?
The InChIKey is SVJUNNKTILBNBJ-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.3Na.Zr/c2-1(3)4;;;;/h(H2,2,3,4);;;;/q;3*+1;+4/p-2.
What are the key properties of trisodium;zirconium(4+);carbonate?
trisodium;zirconium(4+);carbonate has a molecular weight of 220.20 g/mol, XLogP of -11.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;zirconium(4+);carbonate is sourced from PubChem (CID 160948124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).