About CID 170997496
CID 170997496 (PubChem CID 170997496) has the molecular formula CH2CoO4-2
and a molecular weight of 136.96 g/mol.
Molecular Properties
| Compound Name | CID 170997496 |
| PubChem CID | 170997496 |
| Molecular Formula | CH2CoO4-2 |
| Molecular Weight | 136.96 g/mol |
| Exact Mass | 136.93 |
| IUPAC Name | — |
| SMILES | O.O=C([O-])[O-].[Co] |
| InChI | InChI=1S/CH2O3.Co.H2O/c2-1(3)4;;/h(H2,2,3,4);;1H2/p-2 |
| InChIKey | AMBICLBCMQSUDI-UHFFFAOYSA-L |
| XLogP | -3.27 |
| TPSA | 94.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.96 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 170997496 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170997496?
The IUPAC name of CID 170997496 (CID 170997496) is not available.
What is the SMILES notation for CID 170997496?
The canonical SMILES for CID 170997496 is O.O=C([O-])[O-].[Co].
What is the InChIKey of CID 170997496?
The InChIKey is AMBICLBCMQSUDI-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Co.H2O/c2-1(3)4;;/h(H2,2,3,4);;1H2/p-2.
What are the key properties of CID 170997496?
CID 170997496 has a molecular weight of 136.96 g/mol, XLogP of -3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170997496 is sourced from PubChem (CID 170997496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).