About magnesium;carbonate;pentahydrate
magnesium;carbonate;pentahydrate (PubChem CID 22723706) has the molecular formula CH10MgO8
and a molecular weight of 174.39 g/mol. Its IUPAC name is magnesium;carbonate;pentahydrate.
Molecular Properties
| Compound Name | magnesium;carbonate;pentahydrate |
| PubChem CID | 22723706 |
| Molecular Formula | CH10MgO8 |
| Molecular Weight | 174.39 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | magnesium;carbonate;pentahydrate |
| SMILES | O.O.O.O.O.O=C([O-])[O-].[Mg+2] |
| InChI | InChI=1S/CH2O3.Mg.5H2O/c2-1(3)4;;;;;;/h(H2,2,3,4);;5*1H2/q;+2;;;;;/p-2 |
| InChIKey | VTYCBVOPODCEFZ-UHFFFAOYSA-L |
| XLogP | -6.95 |
| TPSA | 220.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.39 |
| LogP ≤ 5 | -6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze magnesium;carbonate;pentahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;carbonate;pentahydrate?
The IUPAC name of magnesium;carbonate;pentahydrate (CID 22723706) is magnesium;carbonate;pentahydrate.
What is the SMILES notation for magnesium;carbonate;pentahydrate?
The canonical SMILES for magnesium;carbonate;pentahydrate is O.O.O.O.O.O=C([O-])[O-].[Mg+2].
What is the InChIKey of magnesium;carbonate;pentahydrate?
The InChIKey is VTYCBVOPODCEFZ-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Mg.5H2O/c2-1(3)4;;;;;;/h(H2,2,3,4);;5*1H2/q;+2;;;;;/p-2.
What are the key properties of magnesium;carbonate;pentahydrate?
magnesium;carbonate;pentahydrate has a molecular weight of 174.39 g/mol, XLogP of -6.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;carbonate;pentahydrate is sourced from PubChem (CID 22723706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).