About magnesium;oxalate;tetrahydrate
magnesium;oxalate;tetrahydrate (PubChem CID 171477139) has the molecular formula C2H8MgO8
and a molecular weight of 184.38 g/mol. Its IUPAC name is magnesium;oxalate;tetrahydrate.
Molecular Properties
| Compound Name | magnesium;oxalate;tetrahydrate |
| PubChem CID | 171477139 |
| Molecular Formula | C2H8MgO8 |
| Molecular Weight | 184.38 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | magnesium;oxalate;tetrahydrate |
| SMILES | O.O.O.O.O=C([O-])C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C2H2O4.Mg.4H2O/c3-1(4)2(5)6;;;;;/h(H,3,4)(H,5,6);;4*1H2/q;+2;;;;/p-2 |
| InChIKey | DYEUWBFEAAPAKF-UHFFFAOYSA-L |
| XLogP | -7.19 |
| TPSA | 206.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.38 |
| LogP ≤ 5 | -7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze magnesium;oxalate;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;oxalate;tetrahydrate?
The IUPAC name of magnesium;oxalate;tetrahydrate (CID 171477139) is magnesium;oxalate;tetrahydrate.
What is the SMILES notation for magnesium;oxalate;tetrahydrate?
The canonical SMILES for magnesium;oxalate;tetrahydrate is O.O.O.O.O=C([O-])C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium;oxalate;tetrahydrate?
The InChIKey is DYEUWBFEAAPAKF-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.Mg.4H2O/c3-1(4)2(5)6;;;;;/h(H,3,4)(H,5,6);;4*1H2/q;+2;;;;/p-2.
What are the key properties of magnesium;oxalate;tetrahydrate?
magnesium;oxalate;tetrahydrate has a molecular weight of 184.38 g/mol, XLogP of -7.19, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;oxalate;tetrahydrate is sourced from PubChem (CID 171477139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).