About magnesium;sodium;oxalate
magnesium;sodium;oxalate (PubChem CID 157163554) has the molecular formula C2MgNaO4+
and a molecular weight of 135.31 g/mol. Its IUPAC name is magnesium;sodium;oxalate.
Molecular Properties
| Compound Name | magnesium;sodium;oxalate |
| PubChem CID | 157163554 |
| Molecular Formula | C2MgNaO4+ |
| Molecular Weight | 135.31 g/mol |
| Exact Mass | 134.95 |
| IUPAC Name | magnesium;sodium;oxalate |
| SMILES | O=C([O-])C(=O)[O-].[Mg+2].[Na+] |
| InChI | InChI=1S/C2H2O4.Mg.Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;+2;+1/p-2 |
| InChIKey | AMQNRFVUFRQLSV-UHFFFAOYSA-L |
| XLogP | -6.89 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.31 |
| LogP ≤ 5 | -6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze magnesium;sodium;oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;sodium;oxalate?
The IUPAC name of magnesium;sodium;oxalate (CID 157163554) is magnesium;sodium;oxalate.
What is the SMILES notation for magnesium;sodium;oxalate?
The canonical SMILES for magnesium;sodium;oxalate is O=C([O-])C(=O)[O-].[Mg+2].[Na+].
What is the InChIKey of magnesium;sodium;oxalate?
The InChIKey is AMQNRFVUFRQLSV-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.Mg.Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;+2;+1/p-2.
What are the key properties of magnesium;sodium;oxalate?
magnesium;sodium;oxalate has a molecular weight of 135.31 g/mol, XLogP of -6.89, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;sodium;oxalate is sourced from PubChem (CID 157163554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).