About calcium;carbonate;hydrate
calcium;carbonate;hydrate (PubChem CID 23282065) has the molecular formula CH2CaO4
and a molecular weight of 118.10 g/mol. Its IUPAC name is calcium;carbonate;hydrate.
Molecular Properties
| Compound Name | calcium;carbonate;hydrate |
| PubChem CID | 23282065 |
| Molecular Formula | CH2CaO4 |
| Molecular Weight | 118.10 g/mol |
| Exact Mass | 117.96 |
| IUPAC Name | calcium;carbonate;hydrate |
| SMILES | O.O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/CH2O3.Ca.H2O/c2-1(3)4;;/h(H2,2,3,4);;1H2/q;+2;/p-2 |
| InChIKey | VMLAJPONBZSGBD-UHFFFAOYSA-L |
| XLogP | -3.65 |
| TPSA | 94.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.10 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze calcium;carbonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;carbonate;hydrate?
The IUPAC name of calcium;carbonate;hydrate (CID 23282065) is calcium;carbonate;hydrate.
What is the SMILES notation for calcium;carbonate;hydrate?
The canonical SMILES for calcium;carbonate;hydrate is O.O=C([O-])[O-].[Ca+2].
What is the InChIKey of calcium;carbonate;hydrate?
The InChIKey is VMLAJPONBZSGBD-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Ca.H2O/c2-1(3)4;;/h(H2,2,3,4);;1H2/q;+2;/p-2.
What are the key properties of calcium;carbonate;hydrate?
calcium;carbonate;hydrate has a molecular weight of 118.10 g/mol, XLogP of -3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;carbonate;hydrate is sourced from PubChem (CID 23282065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).