About calcium;ruthenium;carbonate
calcium;ruthenium;carbonate (PubChem CID 87309849) has the molecular formula CCaO3Ru
and a molecular weight of 201.16 g/mol. Its IUPAC name is calcium;ruthenium;carbonate.
Molecular Properties
| Compound Name | calcium;ruthenium;carbonate |
| PubChem CID | 87309849 |
| Molecular Formula | CCaO3Ru |
| Molecular Weight | 201.16 g/mol |
| Exact Mass | 201.85 |
| IUPAC Name | calcium;ruthenium;carbonate |
| SMILES | O=C([O-])[O-].[Ca+2].[Ru] |
| InChI | InChI=1S/CH2O3.Ca.Ru/c2-1(3)4;;/h(H2,2,3,4);;/q;+2;/p-2 |
| InChIKey | JQQYSZADRVJWFO-UHFFFAOYSA-L |
| XLogP | -2.83 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.16 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze calcium;ruthenium;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;ruthenium;carbonate?
The IUPAC name of calcium;ruthenium;carbonate (CID 87309849) is calcium;ruthenium;carbonate.
What is the SMILES notation for calcium;ruthenium;carbonate?
The canonical SMILES for calcium;ruthenium;carbonate is O=C([O-])[O-].[Ca+2].[Ru].
What is the InChIKey of calcium;ruthenium;carbonate?
The InChIKey is JQQYSZADRVJWFO-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Ca.Ru/c2-1(3)4;;/h(H2,2,3,4);;/q;+2;/p-2.
What are the key properties of calcium;ruthenium;carbonate?
calcium;ruthenium;carbonate has a molecular weight of 201.16 g/mol, XLogP of -2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;ruthenium;carbonate is sourced from PubChem (CID 87309849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).