About bis(nickel(2+));oxalate;carbonate
bis(nickel(2+));oxalate;carbonate (PubChem CID 173301316) has the molecular formula C3Ni2O7
and a molecular weight of 265.41 g/mol. Its IUPAC name is bis(nickel(2+));oxalate;carbonate.
Molecular Properties
| Compound Name | bis(nickel(2+));oxalate;carbonate |
| PubChem CID | 173301316 |
| Molecular Formula | C3Ni2O7 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 263.84 |
| IUPAC Name | bis(nickel(2+));oxalate;carbonate |
| SMILES | O=C([O-])C(=O)[O-].O=C([O-])[O-].[Ni+2].[Ni+2] |
| InChI | InChI=1S/C2H2O4.CH2O3.2Ni/c3-1(4)2(5)6;2-1(3)4;;/h(H,3,4)(H,5,6);(H2,2,3,4);;/q;;2*+2/p-4 |
| InChIKey | FVRPZILTPHOFFJ-UHFFFAOYSA-J |
| XLogP | -5.97 |
| TPSA | 143.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | -5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(nickel(2+));oxalate;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(nickel(2+));oxalate;carbonate?
The IUPAC name of bis(nickel(2+));oxalate;carbonate (CID 173301316) is bis(nickel(2+));oxalate;carbonate.
What is the SMILES notation for bis(nickel(2+));oxalate;carbonate?
The canonical SMILES for bis(nickel(2+));oxalate;carbonate is O=C([O-])C(=O)[O-].O=C([O-])[O-].[Ni+2].[Ni+2].
What is the InChIKey of bis(nickel(2+));oxalate;carbonate?
The InChIKey is FVRPZILTPHOFFJ-UHFFFAOYSA-J. The full InChI is InChI=1S/C2H2O4.CH2O3.2Ni/c3-1(4)2(5)6;2-1(3)4;;/h(H,3,4)(H,5,6);(H2,2,3,4);;/q;;2*+2/p-4.
What are the key properties of bis(nickel(2+));oxalate;carbonate?
bis(nickel(2+));oxalate;carbonate has a molecular weight of 265.41 g/mol, XLogP of -5.97, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(nickel(2+));oxalate;carbonate is sourced from PubChem (CID 173301316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).