About silver;nickel(2+);oxalate
silver;nickel(2+);oxalate (PubChem CID 159248899) has the molecular formula C2AgNiO4+
and a molecular weight of 254.58 g/mol. Its IUPAC name is silver;nickel(2+);oxalate.
Molecular Properties
| Compound Name | silver;nickel(2+);oxalate |
| PubChem CID | 159248899 |
| Molecular Formula | C2AgNiO4+ |
| Molecular Weight | 254.58 g/mol |
| Exact Mass | 252.82 |
| IUPAC Name | silver;nickel(2+);oxalate |
| SMILES | O=C([O-])C(=O)[O-].[Ag+].[Ni+2] |
| InChI | InChI=1S/C2H2O4.Ag.Ni/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;+1;+2/p-2 |
| InChIKey | HAQHFPYIHHIFIR-UHFFFAOYSA-L |
| XLogP | -3.52 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.58 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze silver;nickel(2+);oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;nickel(2+);oxalate?
The IUPAC name of silver;nickel(2+);oxalate (CID 159248899) is silver;nickel(2+);oxalate.
What is the SMILES notation for silver;nickel(2+);oxalate?
The canonical SMILES for silver;nickel(2+);oxalate is O=C([O-])C(=O)[O-].[Ag+].[Ni+2].
What is the InChIKey of silver;nickel(2+);oxalate?
The InChIKey is HAQHFPYIHHIFIR-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.Ag.Ni/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;+1;+2/p-2.
What are the key properties of silver;nickel(2+);oxalate?
silver;nickel(2+);oxalate has a molecular weight of 254.58 g/mol, XLogP of -3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver;nickel(2+);oxalate is sourced from PubChem (CID 159248899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).