About tetraazanium;oxalate;carbonate
tetraazanium;oxalate;carbonate (PubChem CID 141480111) has the molecular formula C3H16N4O7
and a molecular weight of 220.18 g/mol. Its IUPAC name is tetraazanium;oxalate;carbonate.
Molecular Properties
| Compound Name | tetraazanium;oxalate;carbonate |
| PubChem CID | 141480111 |
| Molecular Formula | C3H16N4O7 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | tetraazanium;oxalate;carbonate |
| SMILES | O=C([O-])C(=O)[O-].O=C([O-])[O-].[NH4+].[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C2H2O4.CH2O3.4H3N/c3-1(4)2(5)6;2-1(3)4;;;;/h(H,3,4)(H,5,6);(H2,2,3,4);4*1H3 |
| InChIKey | PVXKGZUYXXYHEC-UHFFFAOYSA-N |
| XLogP | -4.46 |
| TPSA | 289.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tetraazanium;oxalate;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraazanium;oxalate;carbonate?
The IUPAC name of tetraazanium;oxalate;carbonate (CID 141480111) is tetraazanium;oxalate;carbonate.
What is the SMILES notation for tetraazanium;oxalate;carbonate?
The canonical SMILES for tetraazanium;oxalate;carbonate is O=C([O-])C(=O)[O-].O=C([O-])[O-].[NH4+].[NH4+].[NH4+].[NH4+].
What is the InChIKey of tetraazanium;oxalate;carbonate?
The InChIKey is PVXKGZUYXXYHEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.CH2O3.4H3N/c3-1(4)2(5)6;2-1(3)4;;;;/h(H,3,4)(H,5,6);(H2,2,3,4);4*1H3.
What are the key properties of tetraazanium;oxalate;carbonate?
tetraazanium;oxalate;carbonate has a molecular weight of 220.18 g/mol, XLogP of -4.46, 0 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tetraazanium;oxalate;carbonate is sourced from PubChem (CID 141480111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).