About aluminum;zinc;carbonate
aluminum;zinc;carbonate (PubChem CID 162187008) has the molecular formula CAlO3Zn+3
and a molecular weight of 152.38 g/mol. Its IUPAC name is aluminum;zinc;carbonate.
Molecular Properties
| Compound Name | aluminum;zinc;carbonate |
| PubChem CID | 162187008 |
| Molecular Formula | CAlO3Zn+3 |
| Molecular Weight | 152.38 g/mol |
| Exact Mass | 150.89 |
| IUPAC Name | aluminum;zinc;carbonate |
| SMILES | O=C([O-])[O-].[Al+3].[Zn+2] |
| InChI | InChI=1S/CH2O3.Al.Zn/c2-1(3)4;;/h(H2,2,3,4);;/q;+3;+2/p-2 |
| InChIKey | ZPUBJHQABOZYOK-UHFFFAOYSA-L |
| XLogP | -2.83 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.38 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze aluminum;zinc;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;zinc;carbonate?
The IUPAC name of aluminum;zinc;carbonate (CID 162187008) is aluminum;zinc;carbonate.
What is the SMILES notation for aluminum;zinc;carbonate?
The canonical SMILES for aluminum;zinc;carbonate is O=C([O-])[O-].[Al+3].[Zn+2].
What is the InChIKey of aluminum;zinc;carbonate?
The InChIKey is ZPUBJHQABOZYOK-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Al.Zn/c2-1(3)4;;/h(H2,2,3,4);;/q;+3;+2/p-2.
What are the key properties of aluminum;zinc;carbonate?
aluminum;zinc;carbonate has a molecular weight of 152.38 g/mol, XLogP of -2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;zinc;carbonate is sourced from PubChem (CID 162187008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).