About potassium;hafnium(4+);carbonate
potassium;hafnium(4+);carbonate (PubChem CID 19377245) has the molecular formula CHfKO3+3
and a molecular weight of 277.60 g/mol. Its IUPAC name is potassium;hafnium(4+);carbonate.
Molecular Properties
| Compound Name | potassium;hafnium(4+);carbonate |
| PubChem CID | 19377245 |
| Molecular Formula | CHfKO3+3 |
| Molecular Weight | 277.60 g/mol |
| Exact Mass | 278.89 |
| IUPAC Name | potassium;hafnium(4+);carbonate |
| SMILES | O=C([O-])[O-].[Hf+4].[K+] |
| InChI | InChI=1S/CH2O3.Hf.K/c2-1(3)4;;/h(H2,2,3,4);;/q;+4;+1/p-2 |
| InChIKey | DBBBCSFFKKGIME-UHFFFAOYSA-L |
| XLogP | -5.45 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.60 |
| LogP ≤ 5 | -5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;hafnium(4+);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hafnium(4+);carbonate?
The IUPAC name of potassium;hafnium(4+);carbonate (CID 19377245) is potassium;hafnium(4+);carbonate.
What is the SMILES notation for potassium;hafnium(4+);carbonate?
The canonical SMILES for potassium;hafnium(4+);carbonate is O=C([O-])[O-].[Hf+4].[K+].
What is the InChIKey of potassium;hafnium(4+);carbonate?
The InChIKey is DBBBCSFFKKGIME-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Hf.K/c2-1(3)4;;/h(H2,2,3,4);;/q;+4;+1/p-2.
What are the key properties of potassium;hafnium(4+);carbonate?
potassium;hafnium(4+);carbonate has a molecular weight of 277.60 g/mol, XLogP of -5.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hafnium(4+);carbonate is sourced from PubChem (CID 19377245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).