About dipotassium;phosphane;carbonate
dipotassium;phosphane;carbonate (PubChem CID 161306374) has the molecular formula CH3K2O3P
and a molecular weight of 172.20 g/mol. Its IUPAC name is dipotassium;phosphane;carbonate.
Molecular Properties
| Compound Name | dipotassium;phosphane;carbonate |
| PubChem CID | 161306374 |
| Molecular Formula | CH3K2O3P |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 171.91 |
| IUPAC Name | dipotassium;phosphane;carbonate |
| SMILES | O=C([O-])[O-].P.[K+].[K+] |
| InChI | InChI=1S/CH2O3.2K.H3P/c2-1(3)4;;;/h(H2,2,3,4);;;1H3/q;2*+1;/p-2 |
| InChIKey | VIHKRHREXOZXSB-UHFFFAOYSA-L |
| XLogP | -8.38 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | -8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;phosphane;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;phosphane;carbonate?
The IUPAC name of dipotassium;phosphane;carbonate (CID 161306374) is dipotassium;phosphane;carbonate.
What is the SMILES notation for dipotassium;phosphane;carbonate?
The canonical SMILES for dipotassium;phosphane;carbonate is O=C([O-])[O-].P.[K+].[K+].
What is the InChIKey of dipotassium;phosphane;carbonate?
The InChIKey is VIHKRHREXOZXSB-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.2K.H3P/c2-1(3)4;;;/h(H2,2,3,4);;;1H3/q;2*+1;/p-2.
What are the key properties of dipotassium;phosphane;carbonate?
dipotassium;phosphane;carbonate has a molecular weight of 172.20 g/mol, XLogP of -8.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;phosphane;carbonate is sourced from PubChem (CID 161306374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).