About azanium;uranium(2+);carbonate
azanium;uranium(2+);carbonate (PubChem CID 21149382) has the molecular formula CH4NO3U+
and a molecular weight of 316.08 g/mol. Its IUPAC name is azanium;uranium(2+);carbonate.
Molecular Properties
| Compound Name | azanium;uranium(2+);carbonate |
| PubChem CID | 21149382 |
| Molecular Formula | CH4NO3U+ |
| Molecular Weight | 316.08 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | azanium;uranium(2+);carbonate |
| SMILES | O=C([O-])[O-].[NH4+].[U+2] |
| InChI | InChI=1S/CH2O3.H3N.U/c2-1(3)4;;/h(H2,2,3,4);1H3;/q;;+2/p-1 |
| InChIKey | GKPRBTJKQYZTEA-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.08 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azanium;uranium(2+);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;uranium(2+);carbonate?
The IUPAC name of azanium;uranium(2+);carbonate (CID 21149382) is azanium;uranium(2+);carbonate.
What is the SMILES notation for azanium;uranium(2+);carbonate?
The canonical SMILES for azanium;uranium(2+);carbonate is O=C([O-])[O-].[NH4+].[U+2].
What is the InChIKey of azanium;uranium(2+);carbonate?
The InChIKey is GKPRBTJKQYZTEA-UHFFFAOYSA-M. The full InChI is InChI=1S/CH2O3.H3N.U/c2-1(3)4;;/h(H2,2,3,4);1H3;/q;;+2/p-1.
What are the key properties of azanium;uranium(2+);carbonate?
azanium;uranium(2+);carbonate has a molecular weight of 316.08 g/mol, XLogP of -2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;uranium(2+);carbonate is sourced from PubChem (CID 21149382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).