C6H6Cl2O2 — CID 20515761
1,5-dichloro-3-methylidenepentane-2,4-dione (PubChem CID 20515761) has the molecular formula C6H6Cl2O2 and a molecular weight of 181.02 g/mol. Its IUPAC name is 1,5-dichloro-3-methylidenepentane-2,4-dione.
| Compound Name | 1,5-dichloro-3-methylidenepentane-2,4-dione |
|---|---|
| PubChem CID | 20515761 |
| Molecular Formula | C6H6Cl2O2 |
| Molecular Weight | 181.02 g/mol |
| Exact Mass | 179.97 |
| IUPAC Name | 1,5-dichloro-3-methylidenepentane-2,4-dione |
| SMILES | C=C(C(=O)CCl)C(=O)CCl |
| InChI | InChI=1S/C6H6Cl2O2/c1-4(5(9)2-7)6(10)3-8/h1-3H2 |
| InChIKey | JCKZLIGIIUMALD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.02 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|