About magnesium;2-chloroacetate;chloride
magnesium;2-chloroacetate;chloride (PubChem CID 18003403) has the molecular formula C2H2Cl2MgO2
and a molecular weight of 153.25 g/mol. Its IUPAC name is magnesium;2-chloroacetate;chloride.
Molecular Properties
| Compound Name | magnesium;2-chloroacetate;chloride |
| PubChem CID | 18003403 |
| Molecular Formula | C2H2Cl2MgO2 |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 151.93 |
| IUPAC Name | magnesium;2-chloroacetate;chloride |
| SMILES | O=C([O-])CCl.[Cl-].[Mg+2] |
| InChI | InChI=1S/C2H3ClO2.ClH.Mg/c3-1-2(4)5;;/h1H2,(H,4,5);1H;/q;;+2/p-2 |
| InChIKey | FQJYGNZBLZBJLS-UHFFFAOYSA-L |
| XLogP | -4.40 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-chloroacetate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-chloroacetate;chloride?
The IUPAC name of magnesium;2-chloroacetate;chloride (CID 18003403) is magnesium;2-chloroacetate;chloride.
What is the SMILES notation for magnesium;2-chloroacetate;chloride?
The canonical SMILES for magnesium;2-chloroacetate;chloride is O=C([O-])CCl.[Cl-].[Mg+2].
What is the InChIKey of magnesium;2-chloroacetate;chloride?
The InChIKey is FQJYGNZBLZBJLS-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H3ClO2.ClH.Mg/c3-1-2(4)5;;/h1H2,(H,4,5);1H;/q;;+2/p-2.
What are the key properties of magnesium;2-chloroacetate;chloride?
magnesium;2-chloroacetate;chloride has a molecular weight of 153.25 g/mol, XLogP of -4.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-chloroacetate;chloride is sourced from PubChem (CID 18003403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).