About magnesium;2-hydroxyacetate;chloride
magnesium;2-hydroxyacetate;chloride (PubChem CID 18799087) has the molecular formula C2H3ClMgO3
and a molecular weight of 134.80 g/mol. Its IUPAC name is magnesium;2-hydroxyacetate;chloride.
Molecular Properties
| Compound Name | magnesium;2-hydroxyacetate;chloride |
| PubChem CID | 18799087 |
| Molecular Formula | C2H3ClMgO3 |
| Molecular Weight | 134.80 g/mol |
| Exact Mass | 133.96 |
| IUPAC Name | magnesium;2-hydroxyacetate;chloride |
| SMILES | O=C([O-])CO.[Cl-].[Mg+2] |
| InChI | InChI=1S/C2H4O3.ClH.Mg/c3-1-2(4)5;;/h3H,1H2,(H,4,5);1H;/q;;+2/p-2 |
| InChIKey | WIBVHXDIQAOXSH-UHFFFAOYSA-L |
| XLogP | -5.65 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.80 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze magnesium;2-hydroxyacetate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-hydroxyacetate;chloride?
The IUPAC name of magnesium;2-hydroxyacetate;chloride (CID 18799087) is magnesium;2-hydroxyacetate;chloride.
What is the SMILES notation for magnesium;2-hydroxyacetate;chloride?
The canonical SMILES for magnesium;2-hydroxyacetate;chloride is O=C([O-])CO.[Cl-].[Mg+2].
What is the InChIKey of magnesium;2-hydroxyacetate;chloride?
The InChIKey is WIBVHXDIQAOXSH-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O3.ClH.Mg/c3-1-2(4)5;;/h3H,1H2,(H,4,5);1H;/q;;+2/p-2.
What are the key properties of magnesium;2-hydroxyacetate;chloride?
magnesium;2-hydroxyacetate;chloride has a molecular weight of 134.80 g/mol, XLogP of -5.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-hydroxyacetate;chloride is sourced from PubChem (CID 18799087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).