About 2-hydroxyacetate
2-hydroxyacetate (PubChem CID 5460308) has the molecular formula C2H3O3-
and a molecular weight of 75.04 g/mol. Its IUPAC name is 2-hydroxyacetate.
Molecular Properties
| Compound Name | 2-hydroxyacetate |
| PubChem CID | 5460308 |
| Molecular Formula | C2H3O3- |
| Molecular Weight | 75.04 g/mol |
| Exact Mass | 75.01 |
| IUPAC Name | 2-hydroxyacetate |
| SMILES | O=C([O-])CO |
| InChI | InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/p-1 |
| InChIKey | AEMRFAOFKBGASW-UHFFFAOYSA-M |
| XLogP | -2.27 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.04 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyacetate?
The IUPAC name of 2-hydroxyacetate (CID 5460308) is 2-hydroxyacetate.
What is the SMILES notation for 2-hydroxyacetate?
The canonical SMILES for 2-hydroxyacetate is O=C([O-])CO.
What is the InChIKey of 2-hydroxyacetate?
The InChIKey is AEMRFAOFKBGASW-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/p-1.
What are the key properties of 2-hydroxyacetate?
2-hydroxyacetate has a molecular weight of 75.04 g/mol, XLogP of -2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetate is sourced from PubChem (CID 5460308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).