About azanium;2-hydroxyacetate;titanium
azanium;2-hydroxyacetate;titanium (PubChem CID 173336650) has the molecular formula C2H7NO3Ti
and a molecular weight of 140.95 g/mol. Its IUPAC name is azanium;2-hydroxyacetate;titanium.
Molecular Properties
| Compound Name | azanium;2-hydroxyacetate;titanium |
| PubChem CID | 173336650 |
| Molecular Formula | C2H7NO3Ti |
| Molecular Weight | 140.95 g/mol |
| Exact Mass | 140.99 |
| IUPAC Name | azanium;2-hydroxyacetate;titanium |
| SMILES | O=C([O-])CO.[NH4+].[Ti] |
| InChI | InChI=1S/C2H4O3.H3N.Ti/c3-1-2(4)5;;/h3H,1H2,(H,4,5);1H3; |
| InChIKey | YCYRNEBOHQFDQW-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.95 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azanium;2-hydroxyacetate;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;2-hydroxyacetate;titanium?
The IUPAC name of azanium;2-hydroxyacetate;titanium (CID 173336650) is azanium;2-hydroxyacetate;titanium.
What is the SMILES notation for azanium;2-hydroxyacetate;titanium?
The canonical SMILES for azanium;2-hydroxyacetate;titanium is O=C([O-])CO.[NH4+].[Ti].
What is the InChIKey of azanium;2-hydroxyacetate;titanium?
The InChIKey is YCYRNEBOHQFDQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3.H3N.Ti/c3-1-2(4)5;;/h3H,1H2,(H,4,5);1H3;.
What are the key properties of azanium;2-hydroxyacetate;titanium?
azanium;2-hydroxyacetate;titanium has a molecular weight of 140.95 g/mol, XLogP of -1.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;2-hydroxyacetate;titanium is sourced from PubChem (CID 173336650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).