About azanium;titanium;acetate
azanium;titanium;acetate (PubChem CID 173299620) has the molecular formula C2H7NO2Ti
and a molecular weight of 124.95 g/mol. Its IUPAC name is azanium;titanium;acetate.
Molecular Properties
| Compound Name | azanium;titanium;acetate |
| PubChem CID | 173299620 |
| Molecular Formula | C2H7NO2Ti |
| Molecular Weight | 124.95 g/mol |
| Exact Mass | 125.00 |
| IUPAC Name | azanium;titanium;acetate |
| SMILES | CC(=O)[O-].[NH4+].[Ti] |
| InChI | InChI=1S/C2H4O2.H3N.Ti/c1-2(3)4;;/h1H3,(H,3,4);1H3; |
| InChIKey | LXOTWUWSLPPPPL-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.95 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azanium;titanium;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;titanium;acetate?
The IUPAC name of azanium;titanium;acetate (CID 173299620) is azanium;titanium;acetate.
What is the SMILES notation for azanium;titanium;acetate?
The canonical SMILES for azanium;titanium;acetate is CC(=O)[O-].[NH4+].[Ti].
What is the InChIKey of azanium;titanium;acetate?
The InChIKey is LXOTWUWSLPPPPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.H3N.Ti/c1-2(3)4;;/h1H3,(H,3,4);1H3;.
What are the key properties of azanium;titanium;acetate?
azanium;titanium;acetate has a molecular weight of 124.95 g/mol, XLogP of -0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;titanium;acetate is sourced from PubChem (CID 173299620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).