About zinc bis(2-hydroxyacetate)
zinc bis(2-hydroxyacetate) (PubChem CID 15245444) has the molecular formula C4H6O6Zn
and a molecular weight of 215.48 g/mol. Its IUPAC name is zinc bis(2-hydroxyacetate).
Molecular Properties
| Compound Name | zinc bis(2-hydroxyacetate) |
| PubChem CID | 15245444 |
| Molecular Formula | C4H6O6Zn |
| Molecular Weight | 215.48 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | zinc bis(2-hydroxyacetate) |
| SMILES | O=C([O-])CO.O=C([O-])CO.[Zn+2] |
| InChI | InChI=1S/2C2H4O3.Zn/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | MCOGTQGPHPAUJN-UHFFFAOYSA-L |
| XLogP | -4.55 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.48 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(2-hydroxyacetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(2-hydroxyacetate)?
The IUPAC name of zinc bis(2-hydroxyacetate) (CID 15245444) is zinc bis(2-hydroxyacetate).
What is the SMILES notation for zinc bis(2-hydroxyacetate)?
The canonical SMILES for zinc bis(2-hydroxyacetate) is O=C([O-])CO.O=C([O-])CO.[Zn+2].
What is the InChIKey of zinc bis(2-hydroxyacetate)?
The InChIKey is MCOGTQGPHPAUJN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H4O3.Zn/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q;;+2/p-2.
What are the key properties of zinc bis(2-hydroxyacetate)?
zinc bis(2-hydroxyacetate) has a molecular weight of 215.48 g/mol, XLogP of -4.55, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(2-hydroxyacetate) is sourced from PubChem (CID 15245444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).