About 2-hydroxyacetate;tri(propan-2-yl)azanium
2-hydroxyacetate;tri(propan-2-yl)azanium (PubChem CID 139301397) has the molecular formula C11H25NO3
and a molecular weight of 219.32 g/mol. Its IUPAC name is 2-hydroxyacetate;tri(propan-2-yl)azanium.
Molecular Properties
| Compound Name | 2-hydroxyacetate;tri(propan-2-yl)azanium |
| PubChem CID | 139301397 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 2-hydroxyacetate;tri(propan-2-yl)azanium |
| SMILES | CC(C)[NH+](C(C)C)C(C)C.O=C([O-])CO |
| InChI | InChI=1S/C9H21N.C2H4O3/c1-7(2)10(8(3)4)9(5)6;3-1-2(4)5/h7-9H,1-6H3;3H,1H2,(H,4,5) |
| InChIKey | ZXULGDYJLWQOOM-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyacetate;tri(propan-2-yl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyacetate;tri(propan-2-yl)azanium?
The IUPAC name of 2-hydroxyacetate;tri(propan-2-yl)azanium (CID 139301397) is 2-hydroxyacetate;tri(propan-2-yl)azanium.
What is the SMILES notation for 2-hydroxyacetate;tri(propan-2-yl)azanium?
The canonical SMILES for 2-hydroxyacetate;tri(propan-2-yl)azanium is CC(C)[NH+](C(C)C)C(C)C.O=C([O-])CO.
What is the InChIKey of 2-hydroxyacetate;tri(propan-2-yl)azanium?
The InChIKey is ZXULGDYJLWQOOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.C2H4O3/c1-7(2)10(8(3)4)9(5)6;3-1-2(4)5/h7-9H,1-6H3;3H,1H2,(H,4,5).
What are the key properties of 2-hydroxyacetate;tri(propan-2-yl)azanium?
2-hydroxyacetate;tri(propan-2-yl)azanium has a molecular weight of 219.32 g/mol, XLogP of -1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetate;tri(propan-2-yl)azanium is sourced from PubChem (CID 139301397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).