About 2-hydroxyacetate;iron(2+)
2-hydroxyacetate;iron(2+) (PubChem CID 18504415) has the molecular formula C2H3FeO3+
and a molecular weight of 130.89 g/mol. Its IUPAC name is 2-hydroxyacetate;iron(2+).
Molecular Properties
| Compound Name | 2-hydroxyacetate;iron(2+) |
| PubChem CID | 18504415 |
| Molecular Formula | C2H3FeO3+ |
| Molecular Weight | 130.89 g/mol |
| Exact Mass | 130.94 |
| IUPAC Name | 2-hydroxyacetate;iron(2+) |
| SMILES | O=C([O-])CO.[Fe+2] |
| InChI | InChI=1S/C2H4O3.Fe/c3-1-2(4)5;/h3H,1H2,(H,4,5);/q;+2/p-1 |
| InChIKey | MILTULYKNNTWBL-UHFFFAOYSA-M |
| XLogP | -2.27 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.89 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyacetate;iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyacetate;iron(2+)?
The IUPAC name of 2-hydroxyacetate;iron(2+) (CID 18504415) is 2-hydroxyacetate;iron(2+).
What is the SMILES notation for 2-hydroxyacetate;iron(2+)?
The canonical SMILES for 2-hydroxyacetate;iron(2+) is O=C([O-])CO.[Fe+2].
What is the InChIKey of 2-hydroxyacetate;iron(2+)?
The InChIKey is MILTULYKNNTWBL-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O3.Fe/c3-1-2(4)5;/h3H,1H2,(H,4,5);/q;+2/p-1.
What are the key properties of 2-hydroxyacetate;iron(2+)?
2-hydroxyacetate;iron(2+) has a molecular weight of 130.89 g/mol, XLogP of -2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetate;iron(2+) is sourced from PubChem (CID 18504415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).