About iron(2+);propanedioate
iron(2+);propanedioate (PubChem CID 14944028) has the molecular formula C3H2FeO4
and a molecular weight of 157.89 g/mol. Its IUPAC name is iron(2+);propanedioate.
Molecular Properties
| Compound Name | iron(2+);propanedioate |
| PubChem CID | 14944028 |
| Molecular Formula | C3H2FeO4 |
| Molecular Weight | 157.89 g/mol |
| Exact Mass | 157.93 |
| IUPAC Name | iron(2+);propanedioate |
| SMILES | O=C([O-])CC(=O)[O-].[Fe+2] |
| InChI | InChI=1S/C3H4O4.Fe/c4-2(5)1-3(6)7;/h1H2,(H,4,5)(H,6,7);/q;+2/p-2 |
| InChIKey | QRHVXIXXVNFFMM-UHFFFAOYSA-L |
| XLogP | -3.13 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.89 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);propanedioate?
The IUPAC name of iron(2+);propanedioate (CID 14944028) is iron(2+);propanedioate.
What is the SMILES notation for iron(2+);propanedioate?
The canonical SMILES for iron(2+);propanedioate is O=C([O-])CC(=O)[O-].[Fe+2].
What is the InChIKey of iron(2+);propanedioate?
The InChIKey is QRHVXIXXVNFFMM-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H4O4.Fe/c4-2(5)1-3(6)7;/h1H2,(H,4,5)(H,6,7);/q;+2/p-2.
What are the key properties of iron(2+);propanedioate?
iron(2+);propanedioate has a molecular weight of 157.89 g/mol, XLogP of -3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);propanedioate is sourced from PubChem (CID 14944028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).