About magnesium;3-hydroxy-3-oxopropanoate;hydroxide
magnesium;3-hydroxy-3-oxopropanoate;hydroxide (PubChem CID 72539803) has the molecular formula C3H4MgO5
and a molecular weight of 144.36 g/mol. Its IUPAC name is magnesium;3-hydroxy-3-oxopropanoate;hydroxide.
Molecular Properties
| Compound Name | magnesium;3-hydroxy-3-oxopropanoate;hydroxide |
| PubChem CID | 72539803 |
| Molecular Formula | C3H4MgO5 |
| Molecular Weight | 144.36 g/mol |
| Exact Mass | 143.99 |
| IUPAC Name | magnesium;3-hydroxy-3-oxopropanoate;hydroxide |
| SMILES | O=C([O-])CC(=O)O.[Mg+2].[OH-] |
| InChI | InChI=1S/C3H4O4.Mg.H2O/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;1H2/q;+2;/p-2 |
| InChIKey | GMAYPRQAUVGJLE-UHFFFAOYSA-L |
| XLogP | -2.35 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.36 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze magnesium;3-hydroxy-3-oxopropanoate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;3-hydroxy-3-oxopropanoate;hydroxide?
The IUPAC name of magnesium;3-hydroxy-3-oxopropanoate;hydroxide (CID 72539803) is magnesium;3-hydroxy-3-oxopropanoate;hydroxide.
What is the SMILES notation for magnesium;3-hydroxy-3-oxopropanoate;hydroxide?
The canonical SMILES for magnesium;3-hydroxy-3-oxopropanoate;hydroxide is O=C([O-])CC(=O)O.[Mg+2].[OH-].
What is the InChIKey of magnesium;3-hydroxy-3-oxopropanoate;hydroxide?
The InChIKey is GMAYPRQAUVGJLE-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H4O4.Mg.H2O/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;1H2/q;+2;/p-2.
What are the key properties of magnesium;3-hydroxy-3-oxopropanoate;hydroxide?
magnesium;3-hydroxy-3-oxopropanoate;hydroxide has a molecular weight of 144.36 g/mol, XLogP of -2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;3-hydroxy-3-oxopropanoate;hydroxide is sourced from PubChem (CID 72539803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).