About 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate
1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate (PubChem CID 159014714) has the molecular formula C5H10N2O4
and a molecular weight of 162.15 g/mol. Its IUPAC name is 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate.
Molecular Properties
| Compound Name | 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate |
| PubChem CID | 159014714 |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate |
| SMILES | CC(N)=[NH2+].O=C([O-])CC(=O)O |
| InChI | InChI=1S/C3H4O4.C2H6N2/c4-2(5)1-3(6)7;1-2(3)4/h1H2,(H,4,5)(H,6,7);1H3,(H3,3,4) |
| InChIKey | JSYCMZBXXOJXOA-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate?
The IUPAC name of 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate (CID 159014714) is 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate.
What is the SMILES notation for 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate?
The canonical SMILES for 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate is CC(N)=[NH2+].O=C([O-])CC(=O)O.
What is the InChIKey of 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate?
The InChIKey is JSYCMZBXXOJXOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O4.C2H6N2/c4-2(5)1-3(6)7;1-2(3)4/h1H2,(H,4,5)(H,6,7);1H3,(H3,3,4).
What are the key properties of 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate?
1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate has a molecular weight of 162.15 g/mol, XLogP of -3.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethylideneazanium;3-hydroxy-3-oxopropanoate is sourced from PubChem (CID 159014714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).