About azanium;urea;acetate
azanium;urea;acetate (PubChem CID 87930546) has the molecular formula C3H11N3O3
and a molecular weight of 137.14 g/mol. Its IUPAC name is azanium;urea;acetate.
Molecular Properties
| Compound Name | azanium;urea;acetate |
| PubChem CID | 87930546 |
| Molecular Formula | C3H11N3O3 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | azanium;urea;acetate |
| SMILES | CC(=O)[O-].NC(N)=O.[NH4+] |
| InChI | InChI=1S/C2H4O2.CH4N2O.H3N/c1-2(3)4;2-1(3)4;/h1H3,(H,3,4);(H4,2,3,4);1H3 |
| InChIKey | BYWZLXFSPLNBDL-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azanium;urea;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;urea;acetate?
The IUPAC name of azanium;urea;acetate (CID 87930546) is azanium;urea;acetate.
What is the SMILES notation for azanium;urea;acetate?
The canonical SMILES for azanium;urea;acetate is CC(=O)[O-].NC(N)=O.[NH4+].
What is the InChIKey of azanium;urea;acetate?
The InChIKey is BYWZLXFSPLNBDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.CH4N2O.H3N/c1-2(3)4;2-1(3)4;/h1H3,(H,3,4);(H4,2,3,4);1H3.
What are the key properties of azanium;urea;acetate?
azanium;urea;acetate has a molecular weight of 137.14 g/mol, XLogP of -1.84, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;urea;acetate is sourced from PubChem (CID 87930546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).