About strontium;acetate;fluoride
strontium;acetate;fluoride (PubChem CID 155293129) has the molecular formula C2H3FO2Sr
and a molecular weight of 165.66 g/mol. Its IUPAC name is strontium;acetate;fluoride.
Molecular Properties
| Compound Name | strontium;acetate;fluoride |
| PubChem CID | 155293129 |
| Molecular Formula | C2H3FO2Sr |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.92 |
| IUPAC Name | strontium;acetate;fluoride |
| SMILES | CC(=O)[O-].[F-].[Sr+2] |
| InChI | InChI=1S/C2H4O2.FH.Sr/c1-2(3)4;;/h1H3,(H,3,4);1H;/q;;+2/p-2 |
| InChIKey | FEQHXUSKSDRNNV-UHFFFAOYSA-L |
| XLogP | -4.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze strontium;acetate;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;acetate;fluoride?
The IUPAC name of strontium;acetate;fluoride (CID 155293129) is strontium;acetate;fluoride.
What is the SMILES notation for strontium;acetate;fluoride?
The canonical SMILES for strontium;acetate;fluoride is CC(=O)[O-].[F-].[Sr+2].
What is the InChIKey of strontium;acetate;fluoride?
The InChIKey is FEQHXUSKSDRNNV-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.FH.Sr/c1-2(3)4;;/h1H3,(H,3,4);1H;/q;;+2/p-2.
What are the key properties of strontium;acetate;fluoride?
strontium;acetate;fluoride has a molecular weight of 165.66 g/mol, XLogP of -4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;acetate;fluoride is sourced from PubChem (CID 155293129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).