About dicesium;acetate;fluoride
dicesium;acetate;fluoride (PubChem CID 173118318) has the molecular formula C2H3Cs2FO2
and a molecular weight of 343.85 g/mol. Its IUPAC name is dicesium;acetate;fluoride.
Molecular Properties
| Compound Name | dicesium;acetate;fluoride |
| PubChem CID | 173118318 |
| Molecular Formula | C2H3Cs2FO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.82 |
| IUPAC Name | dicesium;acetate;fluoride |
| SMILES | CC(=O)[O-].[Cs+].[Cs+].[F-] |
| InChI | InChI=1S/C2H4O2.2Cs.FH/c1-2(3)4;;;/h1H3,(H,3,4);;;1H/q;2*+1;/p-2 |
| InChIKey | ONPVRXZRZLWSRN-UHFFFAOYSA-L |
| XLogP | -10.23 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | -10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dicesium;acetate;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicesium;acetate;fluoride?
The IUPAC name of dicesium;acetate;fluoride (CID 173118318) is dicesium;acetate;fluoride.
What is the SMILES notation for dicesium;acetate;fluoride?
The canonical SMILES for dicesium;acetate;fluoride is CC(=O)[O-].[Cs+].[Cs+].[F-].
What is the InChIKey of dicesium;acetate;fluoride?
The InChIKey is ONPVRXZRZLWSRN-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.2Cs.FH/c1-2(3)4;;;/h1H3,(H,3,4);;;1H/q;2*+1;/p-2.
What are the key properties of dicesium;acetate;fluoride?
dicesium;acetate;fluoride has a molecular weight of 343.85 g/mol, XLogP of -10.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dicesium;acetate;fluoride is sourced from PubChem (CID 173118318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).