About cesium;acetate;dihydrate
cesium;acetate;dihydrate (PubChem CID 175372370) has the molecular formula C2H7CsO4
and a molecular weight of 227.98 g/mol. Its IUPAC name is cesium;acetate;dihydrate.
Molecular Properties
| Compound Name | cesium;acetate;dihydrate |
| PubChem CID | 175372370 |
| Molecular Formula | C2H7CsO4 |
| Molecular Weight | 227.98 g/mol |
| Exact Mass | 227.94 |
| IUPAC Name | cesium;acetate;dihydrate |
| SMILES | CC(=O)[O-].O.O.[Cs+] |
| InChI | InChI=1S/C2H4O2.Cs.2H2O/c1-2(3)4;;;/h1H3,(H,3,4);;2*1H2/q;+1;;/p-1 |
| InChIKey | SVNXPQNPMSEOEJ-UHFFFAOYSA-M |
| XLogP | -5.89 |
| TPSA | 103.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.98 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cesium;acetate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;acetate;dihydrate?
The IUPAC name of cesium;acetate;dihydrate (CID 175372370) is cesium;acetate;dihydrate.
What is the SMILES notation for cesium;acetate;dihydrate?
The canonical SMILES for cesium;acetate;dihydrate is CC(=O)[O-].O.O.[Cs+].
What is the InChIKey of cesium;acetate;dihydrate?
The InChIKey is SVNXPQNPMSEOEJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Cs.2H2O/c1-2(3)4;;;/h1H3,(H,3,4);;2*1H2/q;+1;;/p-1.
What are the key properties of cesium;acetate;dihydrate?
cesium;acetate;dihydrate has a molecular weight of 227.98 g/mol, XLogP of -5.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;acetate;dihydrate is sourced from PubChem (CID 175372370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).