About cerium(3+);acetate;hexahydrate
cerium(3+);acetate;hexahydrate (PubChem CID 23158452) has the molecular formula C2H15CeO8+2
and a molecular weight of 307.25 g/mol. Its IUPAC name is cerium(3+);acetate;hexahydrate.
Molecular Properties
| Compound Name | cerium(3+);acetate;hexahydrate |
| PubChem CID | 23158452 |
| Molecular Formula | C2H15CeO8+2 |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | cerium(3+);acetate;hexahydrate |
| SMILES | CC(=O)[O-].O.O.O.O.O.O.[Ce+3] |
| InChI | InChI=1S/C2H4O2.Ce.6H2O/c1-2(3)4;;;;;;;/h1H3,(H,3,4);;6*1H2/q;+3;;;;;;/p-1 |
| InChIKey | BLQAAICOAXOXNF-UHFFFAOYSA-M |
| XLogP | -6.19 |
| TPSA | 229.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | -6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cerium(3+);acetate;hexahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium(3+);acetate;hexahydrate?
The IUPAC name of cerium(3+);acetate;hexahydrate (CID 23158452) is cerium(3+);acetate;hexahydrate.
What is the SMILES notation for cerium(3+);acetate;hexahydrate?
The canonical SMILES for cerium(3+);acetate;hexahydrate is CC(=O)[O-].O.O.O.O.O.O.[Ce+3].
What is the InChIKey of cerium(3+);acetate;hexahydrate?
The InChIKey is BLQAAICOAXOXNF-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Ce.6H2O/c1-2(3)4;;;;;;;/h1H3,(H,3,4);;6*1H2/q;+3;;;;;;/p-1.
What are the key properties of cerium(3+);acetate;hexahydrate?
cerium(3+);acetate;hexahydrate has a molecular weight of 307.25 g/mol, XLogP of -6.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cerium(3+);acetate;hexahydrate is sourced from PubChem (CID 23158452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).